C22H37NO4 — CID 118710952
8-(3-hydroxy-5-pentylphenoxy)-N-[(2R)-1-hydroxypropan-2-yl]octanamide (PubChem CID 118710952) has the molecular formula C22H37NO4 and a molecular weight of 379.54 g/mol. Its IUPAC name is 8-(3-hydroxy-5-pentylphenoxy)-N-[(2R)-1-hydroxypropan-2-yl]octanamide.
| Compound Name | 8-(3-hydroxy-5-pentylphenoxy)-N-[(2R)-1-hydroxypropan-2-yl]octanamide |
|---|---|
| PubChem CID | 118710952 |
| Molecular Formula | C22H37NO4 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.27 |
| IUPAC Name | 8-(3-hydroxy-5-pentylphenoxy)-N-[(2R)-1-hydroxypropan-2-yl]octanamide |
| SMILES | CCCCCc1cc(O)cc(OCCCCCCCC(=O)N[C@H](C)CO)c1 |
| InChI | InChI=1S/C22H37NO4/c1-3-4-8-11-19-14-20(25)16-21(15-19)27-13-10-7-5-6-9-12-22(26)23-18(2)17-24/h14-16,18,24-25H,3-13,17H2,1-2H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | MFZXUEJVICGPCI-GOSISDBHSA-N |
| XLogP | 4.34 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|