C23H31NO4 — CID 11494742
6-(3-hydroxy-5-pentylphenoxy)-N-(4-hydroxyphenyl)hexanamide (PubChem CID 11494742) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is 6-(3-hydroxy-5-pentylphenoxy)-N-(4-hydroxyphenyl)hexanamide.
| Compound Name | 6-(3-hydroxy-5-pentylphenoxy)-N-(4-hydroxyphenyl)hexanamide |
|---|---|
| PubChem CID | 11494742 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | 6-(3-hydroxy-5-pentylphenoxy)-N-(4-hydroxyphenyl)hexanamide |
| SMILES | CCCCCc1cc(O)cc(OCCCCCC(=O)Nc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C23H31NO4/c1-2-3-5-8-18-15-21(26)17-22(16-18)28-14-7-4-6-9-23(27)24-19-10-12-20(25)13-11-19/h10-13,15-17,25-26H,2-9,14H2,1H3,(H,24,27) |
| InChIKey | DBYUPXIMKJSUIP-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|