C26H46O5 — CID 56925871
2-[8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octoxy]propane-1,3-diol (PubChem CID 56925871) has the molecular formula C26H46O5 and a molecular weight of 438.65 g/mol. Its IUPAC name is 2-[8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octoxy]propane-1,3-diol.
| Compound Name | 2-[8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octoxy]propane-1,3-diol |
|---|---|
| PubChem CID | 56925871 |
| Molecular Formula | C26H46O5 |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.33 |
| IUPAC Name | 2-[8-[3-hydroxy-5-(2-methyloctan-2-yl)phenoxy]octoxy]propane-1,3-diol |
| SMILES | CCCCCCC(C)(C)c1cc(O)cc(OCCCCCCCCOC(CO)CO)c1 |
| InChI | InChI=1S/C26H46O5/c1-4-5-6-11-14-26(2,3)22-17-23(29)19-24(18-22)30-15-12-9-7-8-10-13-16-31-25(20-27)21-28/h17-19,25,27-29H,4-16,20-21H2,1-3H3 |
| InChIKey | JCJPUCGVJHINQD-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|