C10H18O — CID 10931690
2-[(1S)-4-methylcyclohex-3-en-1-yl]-1-tritiopropan-1-ol (PubChem CID 10931690) has the molecular formula C10H18O and a molecular weight of 156.26 g/mol. Its IUPAC name is 2-[(1S)-4-methylcyclohex-3-en-1-yl]-1-tritiopropan-1-ol.
| Compound Name | 2-[(1S)-4-methylcyclohex-3-en-1-yl]-1-tritiopropan-1-ol |
|---|---|
| PubChem CID | 10931690 |
| Molecular Formula | C10H18O |
| Molecular Weight | 156.26 g/mol |
| Exact Mass | 156.14 |
| IUPAC Name | 2-[(1S)-4-methylcyclohex-3-en-1-yl]-1-tritiopropan-1-ol |
| SMILES | [3H]C(O)C(C)[C@@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C10H18O/c1-8-3-5-10(6-4-8)9(2)7-11/h3,9-11H,4-7H2,1-2H3/t9?,10-/m1/s1/i7T/t7?,9?,10- |
| InChIKey | ZTYHGIAOVUPAAH-DYYTXPATSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|