C9H10BrN — CID 112713951
4-bromo-2-methyl-3a,7a-dihydro-1H-indole (PubChem CID 112713951) has the molecular formula C9H10BrN and a molecular weight of 212.09 g/mol. Its IUPAC name is 4-bromo-2-methyl-3a,7a-dihydro-1H-indole.
| Compound Name | 4-bromo-2-methyl-3a,7a-dihydro-1H-indole |
|---|---|
| PubChem CID | 112713951 |
| Molecular Formula | C9H10BrN |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 4-bromo-2-methyl-3a,7a-dihydro-1H-indole |
| SMILES | CC1=CC2C(Br)=CC=CC2N1 |
| InChI | InChI=1S/C9H10BrN/c1-6-5-7-8(10)3-2-4-9(7)11-6/h2-5,7,9,11H,1H3 |
| InChIKey | AUMXJOUJAFIPBJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |