C13H19NO — CID 71096840
2-butoxy-3-methyl-3a,7a-dihydro-1H-indole (PubChem CID 71096840) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 2-butoxy-3-methyl-3a,7a-dihydro-1H-indole.
| Compound Name | 2-butoxy-3-methyl-3a,7a-dihydro-1H-indole |
|---|---|
| PubChem CID | 71096840 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 2-butoxy-3-methyl-3a,7a-dihydro-1H-indole |
| SMILES | CCCCOC1=C(C)C2C=CC=CC2N1 |
| InChI | InChI=1S/C13H19NO/c1-3-4-9-15-13-10(2)11-7-5-6-8-12(11)14-13/h5-8,11-12,14H,3-4,9H2,1-2H3 |
| InChIKey | RRVSQCBXEVMIJD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|