C13H23BO2 — CID 101333486
dibutoxy(cyclopenta-2,4-dien-1-yl)borane (PubChem CID 101333486) has the molecular formula C13H23BO2 and a molecular weight of 222.14 g/mol. Its IUPAC name is dibutoxy(cyclopenta-2,4-dien-1-yl)borane.
| Compound Name | dibutoxy(cyclopenta-2,4-dien-1-yl)borane |
|---|---|
| PubChem CID | 101333486 |
| Molecular Formula | C13H23BO2 |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | dibutoxy(cyclopenta-2,4-dien-1-yl)borane |
| SMILES | CCCCOB(OCCCC)C1C=CC=C1 |
| InChI | InChI=1S/C13H23BO2/c1-3-5-11-15-14(16-12-6-4-2)13-9-7-8-10-13/h7-10,13H,3-6,11-12H2,1-2H3 |
| InChIKey | MAHCTDIMYUPQMJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|