6-butoxycyclohexa-2,4-diene-1-carboxylic acid

C11H16O3 — CID 175024071

IUPAC6-butoxycyclohexa-2,4-diene-1-carboxylic acid
SMILESCCCCOC1C=CC=CC1C(=O)O
InChIInChI=1S/C11H16O3/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13/h4-7,9-10H,2-3,8H2,1H3,(H,12,13)
InChIKeyGTKKGGIQZZKBQK-UHFFFAOYSA-N
MW196.25 g/mol
LogP2.00
Rot. Bonds5

About 6-butoxycyclohexa-2,4-diene-1-carboxylic acid

6-butoxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 175024071) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 6-butoxycyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-butoxycyclohexa-2,4-diene-1-carboxylic acid
PubChem CID175024071
Molecular FormulaC11H16O3
Molecular Weight196.25 g/mol
Exact Mass196.11
IUPAC Name6-butoxycyclohexa-2,4-diene-1-carboxylic acid
SMILESCCCCOC1C=CC=CC1C(=O)O
InChIInChI=1S/C11H16O3/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13/h4-7,9-10H,2-3,8H2,1H3,(H,12,13)
InChIKeyGTKKGGIQZZKBQK-UHFFFAOYSA-N
XLogP2.00
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.25
LogP ≤ 52.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-butoxycyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-butoxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-butoxycyclohexa-2,4-diene-1-carboxylic acid (CID 175024071) is 6-butoxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-butoxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-butoxycyclohexa-2,4-diene-1-carboxylic acid is CCCCOC1C=CC=CC1C(=O)O.
What is the InChIKey of 6-butoxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is GTKKGGIQZZKBQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13/h4-7,9-10H,2-3,8H2,1H3,(H,12,13).
What are the key properties of 6-butoxycyclohexa-2,4-diene-1-carboxylic acid?
6-butoxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 196.25 g/mol, XLogP of 2.00, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butoxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 175024071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).