C12H14Cl3OZr — CID 157325487
2,2-di(cyclopenta-2,4-dien-1-yl)ethanol;zirconium(3+);trichloride (PubChem CID 157325487) has the molecular formula C12H14Cl3OZr and a molecular weight of 371.83 g/mol. Its IUPAC name is 2,2-di(cyclopenta-2,4-dien-1-yl)ethanol;zirconium(3+);trichloride.
| Compound Name | 2,2-di(cyclopenta-2,4-dien-1-yl)ethanol;zirconium(3+);trichloride |
|---|---|
| PubChem CID | 157325487 |
| Molecular Formula | C12H14Cl3OZr |
| Molecular Weight | 371.83 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | 2,2-di(cyclopenta-2,4-dien-1-yl)ethanol;zirconium(3+);trichloride |
| SMILES | OCC(C1C=CC=C1)C1C=CC=C1.[Cl-].[Cl-].[Cl-].[Zr+3] |
| InChI | InChI=1S/C12H14O.3ClH.Zr/c13-9-12(10-5-1-2-6-10)11-7-3-4-8-11;;;;/h1-8,10-13H,9H2;3*1H;/q;;;;+3/p-3 |
| InChIKey | LBNPJCVDLVPFNO-UHFFFAOYSA-K |
| XLogP | -6.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.83 |
| LogP ≤ 5 | -6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |