C12H17O2P — CID 134549069
3-cyclohepta-2,4,6-trien-1-yl-2-dimethylphosphanylpropanoic acid (PubChem CID 134549069) has the molecular formula C12H17O2P and a molecular weight of 224.24 g/mol. Its IUPAC name is 3-cyclohepta-2,4,6-trien-1-yl-2-dimethylphosphanylpropanoic acid.
| Compound Name | 3-cyclohepta-2,4,6-trien-1-yl-2-dimethylphosphanylpropanoic acid |
|---|---|
| PubChem CID | 134549069 |
| Molecular Formula | C12H17O2P |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-cyclohepta-2,4,6-trien-1-yl-2-dimethylphosphanylpropanoic acid |
| SMILES | CP(C)C(CC1C=CC=CC=C1)C(=O)O |
| InChI | InChI=1S/C12H17O2P/c1-15(2)11(12(13)14)9-10-7-5-3-4-6-8-10/h3-8,10-11H,9H2,1-2H3,(H,13,14) |
| InChIKey | SCIPDHNIOUENFD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|