C14H19NO5 — CID 178075831
(2S)-2-(4-cyclopenta-2,4-dien-1-ylbutanoylamino)pentanedioic acid (PubChem CID 178075831) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is (2S)-2-(4-cyclopenta-2,4-dien-1-ylbutanoylamino)pentanedioic acid.
| Compound Name | (2S)-2-(4-cyclopenta-2,4-dien-1-ylbutanoylamino)pentanedioic acid |
|---|---|
| PubChem CID | 178075831 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (2S)-2-(4-cyclopenta-2,4-dien-1-ylbutanoylamino)pentanedioic acid |
| SMILES | O=C(O)CC[C@H](NC(=O)CCCC1C=CC=C1)C(=O)O |
| InChI | InChI=1S/C14H19NO5/c16-12(7-3-6-10-4-1-2-5-10)15-11(14(19)20)8-9-13(17)18/h1-2,4-5,10-11H,3,6-9H2,(H,15,16)(H,17,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | RXMPUYSAMJSQJX-NSHDSACASA-N |
| XLogP | 1.33 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |