About (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal
(2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal (PubChem CID 131069095) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal.
Molecular Properties
| Compound Name | (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal |
| PubChem CID | 131069095 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal |
| SMILES | CC[C@H](C=O)C1C=CC=CC=C1 |
| InChI | InChI=1S/C11H14O/c1-2-10(9-12)11-7-5-3-4-6-8-11/h3-11H,2H2,1H3/t10-/m1/s1 |
| InChIKey | QSTZPHQCHBJKGU-SNVBAGLBSA-N |
| XLogP | 2.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal?
The IUPAC name of (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal (CID 131069095) is (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal.
What is the SMILES notation for (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal?
The canonical SMILES for (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal is CC[C@H](C=O)C1C=CC=CC=C1.
What is the InChIKey of (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal?
The InChIKey is QSTZPHQCHBJKGU-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H14O/c1-2-10(9-12)11-7-5-3-4-6-8-11/h3-11H,2H2,1H3/t10-/m1/s1.
What are the key properties of (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal?
(2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal has a molecular weight of 162.23 g/mol, XLogP of 2.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-cyclohepta-2,4,6-trien-1-ylbutanal is sourced from PubChem (CID 131069095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).