C10H12O — CID 14182945
2-cyclohepta-2,4,6-trien-1-ylpropanal (PubChem CID 14182945) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 2-cyclohepta-2,4,6-trien-1-ylpropanal.
| Compound Name | 2-cyclohepta-2,4,6-trien-1-ylpropanal |
|---|---|
| PubChem CID | 14182945 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2-cyclohepta-2,4,6-trien-1-ylpropanal |
| SMILES | CC(C=O)C1C=CC=CC=C1 |
| InChI | InChI=1S/C10H12O/c1-9(8-11)10-6-4-2-3-5-7-10/h2-10H,1H3 |
| InChIKey | QZEPUMCDSYOAMR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|