C8H11NO2 — CID 87731809
2-(cyclopenta-2,4-dien-1-ylamino)propanoic acid (PubChem CID 87731809) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-(cyclopenta-2,4-dien-1-ylamino)propanoic acid.
| Compound Name | 2-(cyclopenta-2,4-dien-1-ylamino)propanoic acid |
|---|---|
| PubChem CID | 87731809 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2-(cyclopenta-2,4-dien-1-ylamino)propanoic acid |
| SMILES | CC(NC1C=CC=C1)C(=O)O |
| InChI | InChI=1S/C8H11NO2/c1-6(8(10)11)9-7-4-2-3-5-7/h2-7,9H,1H3,(H,10,11) |
| InChIKey | RUESBRXFGQQPQA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |