About cyclohexa-3,5-diene-1,2-dicarbaldehyde
cyclohexa-3,5-diene-1,2-dicarbaldehyde (PubChem CID 89390135) has the molecular formula C8H8O2
and a molecular weight of 136.15 g/mol. Its IUPAC name is cyclohexa-3,5-diene-1,2-dicarbaldehyde.
Molecular Properties
| Compound Name | cyclohexa-3,5-diene-1,2-dicarbaldehyde |
| PubChem CID | 89390135 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | cyclohexa-3,5-diene-1,2-dicarbaldehyde |
| SMILES | O=CC1C=CC=CC1C=O |
| InChI | InChI=1S/C8H8O2/c9-5-7-3-1-2-4-8(7)6-10/h1-8H |
| InChIKey | LBKMEBHFWYJROT-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cyclohexa-3,5-diene-1,2-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexa-3,5-diene-1,2-dicarbaldehyde?
The IUPAC name of cyclohexa-3,5-diene-1,2-dicarbaldehyde (CID 89390135) is cyclohexa-3,5-diene-1,2-dicarbaldehyde.
What is the SMILES notation for cyclohexa-3,5-diene-1,2-dicarbaldehyde?
The canonical SMILES for cyclohexa-3,5-diene-1,2-dicarbaldehyde is O=CC1C=CC=CC1C=O.
What is the InChIKey of cyclohexa-3,5-diene-1,2-dicarbaldehyde?
The InChIKey is LBKMEBHFWYJROT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O2/c9-5-7-3-1-2-4-8(7)6-10/h1-8H.
What are the key properties of cyclohexa-3,5-diene-1,2-dicarbaldehyde?
cyclohexa-3,5-diene-1,2-dicarbaldehyde has a molecular weight of 136.15 g/mol, XLogP of 0.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexa-3,5-diene-1,2-dicarbaldehyde is sourced from PubChem (CID 89390135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).