C6H8F2O3 — CID 174690239
4-ethyl-4,5-difluoro-1,3-dioxolane-2-carbaldehyde (PubChem CID 174690239) has the molecular formula C6H8F2O3 and a molecular weight of 166.12 g/mol. Its IUPAC name is 4-ethyl-4,5-difluoro-1,3-dioxolane-2-carbaldehyde.
| Compound Name | 4-ethyl-4,5-difluoro-1,3-dioxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 174690239 |
| Molecular Formula | C6H8F2O3 |
| Molecular Weight | 166.12 g/mol |
| Exact Mass | 166.04 |
| IUPAC Name | 4-ethyl-4,5-difluoro-1,3-dioxolane-2-carbaldehyde |
| SMILES | CCC1(F)OC(C=O)OC1F |
| InChI | InChI=1S/C6H8F2O3/c1-2-6(8)5(7)10-4(3-9)11-6/h3-5H,2H2,1H3 |
| InChIKey | NWZAZUWUIZJIPN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.12 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|