C10H16O3 — CID 174516284
4,5-dipropyl-1,3-dioxole-2-carbaldehyde (PubChem CID 174516284) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is 4,5-dipropyl-1,3-dioxole-2-carbaldehyde.
| Compound Name | 4,5-dipropyl-1,3-dioxole-2-carbaldehyde |
|---|---|
| PubChem CID | 174516284 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 4,5-dipropyl-1,3-dioxole-2-carbaldehyde |
| SMILES | CCCC1=C(CCC)OC(C=O)O1 |
| InChI | InChI=1S/C10H16O3/c1-3-5-8-9(6-4-2)13-10(7-11)12-8/h7,10H,3-6H2,1-2H3 |
| InChIKey | KVKNTXDQZBNBJX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|