C8H12O3 — CID 174516282
4-butyl-1,3-dioxole-2-carbaldehyde (PubChem CID 174516282) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 4-butyl-1,3-dioxole-2-carbaldehyde.
| Compound Name | 4-butyl-1,3-dioxole-2-carbaldehyde |
|---|---|
| PubChem CID | 174516282 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4-butyl-1,3-dioxole-2-carbaldehyde |
| SMILES | CCCCC1=COC(C=O)O1 |
| InChI | InChI=1S/C8H12O3/c1-2-3-4-7-6-10-8(5-9)11-7/h5-6,8H,2-4H2,1H3 |
| InChIKey | QBVFDRZUIFYQKJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|