About 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde
4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde (PubChem CID 174682516) has the molecular formula C5H4Cl2O3
and a molecular weight of 182.99 g/mol. Its IUPAC name is 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde.
Molecular Properties
| Compound Name | 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde |
| PubChem CID | 174682516 |
| Molecular Formula | C5H4Cl2O3 |
| Molecular Weight | 182.99 g/mol |
| Exact Mass | 181.95 |
| IUPAC Name | 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde |
| SMILES | O=CC1OC=C(C(Cl)Cl)O1 |
| InChI | InChI=1S/C5H4Cl2O3/c6-5(7)3-2-9-4(1-8)10-3/h1-2,4-5H |
| InChIKey | HSTYTJIGAZVZRW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.99 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde?
The IUPAC name of 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde (CID 174682516) is 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde.
What is the SMILES notation for 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde?
The canonical SMILES for 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde is O=CC1OC=C(C(Cl)Cl)O1.
What is the InChIKey of 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde?
The InChIKey is HSTYTJIGAZVZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4Cl2O3/c6-5(7)3-2-9-4(1-8)10-3/h1-2,4-5H.
What are the key properties of 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde?
4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde has a molecular weight of 182.99 g/mol, XLogP of 1.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dichloromethyl)-1,3-dioxole-2-carbaldehyde is sourced from PubChem (CID 174682516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).