C4H5ClO3 — CID 174481906
4-chloro-1,3-dioxolane-2-carbaldehyde (PubChem CID 174481906) has the molecular formula C4H5ClO3 and a molecular weight of 136.53 g/mol. Its IUPAC name is 4-chloro-1,3-dioxolane-2-carbaldehyde.
| Compound Name | 4-chloro-1,3-dioxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 174481906 |
| Molecular Formula | C4H5ClO3 |
| Molecular Weight | 136.53 g/mol |
| Exact Mass | 135.99 |
| IUPAC Name | 4-chloro-1,3-dioxolane-2-carbaldehyde |
| SMILES | O=CC1OCC(Cl)O1 |
| InChI | InChI=1S/C4H5ClO3/c5-3-2-7-4(1-6)8-3/h1,3-4H,2H2 |
| InChIKey | JHZFPTFBOUWQDN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.53 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|