C8H10O4 — CID 129267682
(3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-dicarbaldehyde (PubChem CID 129267682) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-dicarbaldehyde.
| Compound Name | (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-dicarbaldehyde |
|---|---|
| PubChem CID | 129267682 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | (3aR,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-dicarbaldehyde |
| SMILES | O=CC1CO[C@@H]2C(C=O)CO[C@H]12 |
| InChI | InChI=1S/C8H10O4/c9-1-5-3-11-8-6(2-10)4-12-7(5)8/h1-2,5-8H,3-4H2/t5?,6?,7-,8-/m1/s1 |
| InChIKey | RTCGFXRWVMUOFY-DWYQZRHDSA-N |
| XLogP | -0.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|