C8H14O4 — CID 174783735
4-(propan-2-yloxymethyl)-1,3-dioxolane-2-carbaldehyde (PubChem CID 174783735) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 4-(propan-2-yloxymethyl)-1,3-dioxolane-2-carbaldehyde.
| Compound Name | 4-(propan-2-yloxymethyl)-1,3-dioxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 174783735 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 4-(propan-2-yloxymethyl)-1,3-dioxolane-2-carbaldehyde |
| SMILES | CC(C)OCC1COC(C=O)O1 |
| InChI | InChI=1S/C8H14O4/c1-6(2)10-4-7-5-11-8(3-9)12-7/h3,6-8H,4-5H2,1-2H3 |
| InChIKey | ZBGQILGOQLOPQW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|