C6H9O6S- — CID 174677516
1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite (PubChem CID 174677516) has the molecular formula C6H9O6S- and a molecular weight of 209.20 g/mol. Its IUPAC name is 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite.
| Compound Name | 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite |
|---|---|
| PubChem CID | 174677516 |
| Molecular Formula | C6H9O6S- |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite |
| SMILES | CC(OS(=O)[O-])C1COC(C=O)O1 |
| InChI | InChI=1S/C6H10O6S/c1-4(12-13(8)9)5-3-10-6(2-7)11-5/h2,4-6H,3H2,1H3,(H,8,9)/p-1 |
| InChIKey | LAULOANKZNDIEZ-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|