About 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite
1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite (PubChem CID 174677516) has the molecular formula C6H9O6S-
and a molecular weight of 209.20 g/mol. Its IUPAC name is 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite.
Molecular Properties
| Compound Name | 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite |
| PubChem CID | 174677516 |
| Molecular Formula | C6H9O6S- |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.01 |
| IUPAC Name | 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite |
| SMILES | CC(OS(=O)[O-])C1COC(C=O)O1 |
| InChI | InChI=1S/C6H10O6S/c1-4(12-13(8)9)5-3-10-6(2-7)11-5/h2,4-6H,3H2,1H3,(H,8,9)/p-1 |
| InChIKey | LAULOANKZNDIEZ-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite?
The IUPAC name of 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite (CID 174677516) is 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite.
What is the SMILES notation for 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite?
The canonical SMILES for 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite is CC(OS(=O)[O-])C1COC(C=O)O1.
What is the InChIKey of 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite?
The InChIKey is LAULOANKZNDIEZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H10O6S/c1-4(12-13(8)9)5-3-10-6(2-7)11-5/h2,4-6H,3H2,1H3,(H,8,9)/p-1.
What are the key properties of 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite?
1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite has a molecular weight of 209.20 g/mol, XLogP of -0.87, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-formyl-1,3-dioxolan-4-yl)ethyl sulfite is sourced from PubChem (CID 174677516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).