About 4-methylpentan-2-yl sulfite
4-methylpentan-2-yl sulfite (PubChem CID 57157047) has the molecular formula C6H13O3S-
and a molecular weight of 165.23 g/mol. Its IUPAC name is 4-methylpentan-2-yl sulfite.
Molecular Properties
| Compound Name | 4-methylpentan-2-yl sulfite |
| PubChem CID | 57157047 |
| Molecular Formula | C6H13O3S- |
| Molecular Weight | 165.23 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 4-methylpentan-2-yl sulfite |
| SMILES | CC(C)CC(C)OS(=O)[O-] |
| InChI | InChI=1S/C6H14O3S/c1-5(2)4-6(3)9-10(7)8/h5-6H,4H2,1-3H3,(H,7,8)/p-1 |
| InChIKey | MWMIEIFITKAAOX-UHFFFAOYSA-M |
| XLogP | 1.23 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-methylpentan-2-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpentan-2-yl sulfite?
The IUPAC name of 4-methylpentan-2-yl sulfite (CID 57157047) is 4-methylpentan-2-yl sulfite.
What is the SMILES notation for 4-methylpentan-2-yl sulfite?
The canonical SMILES for 4-methylpentan-2-yl sulfite is CC(C)CC(C)OS(=O)[O-].
What is the InChIKey of 4-methylpentan-2-yl sulfite?
The InChIKey is MWMIEIFITKAAOX-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H14O3S/c1-5(2)4-6(3)9-10(7)8/h5-6H,4H2,1-3H3,(H,7,8)/p-1.
What are the key properties of 4-methylpentan-2-yl sulfite?
4-methylpentan-2-yl sulfite has a molecular weight of 165.23 g/mol, XLogP of 1.23, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpentan-2-yl sulfite is sourced from PubChem (CID 57157047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).