About 1-chloropentyl sulfite
1-chloropentyl sulfite (PubChem CID 174423721) has the molecular formula C5H10ClO3S-
and a molecular weight of 185.65 g/mol. Its IUPAC name is 1-chloropentyl sulfite.
Molecular Properties
| Compound Name | 1-chloropentyl sulfite |
| PubChem CID | 174423721 |
| Molecular Formula | C5H10ClO3S- |
| Molecular Weight | 185.65 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | 1-chloropentyl sulfite |
| SMILES | CCCCC(Cl)OS(=O)[O-] |
| InChI | InChI=1S/C5H11ClO3S/c1-2-3-4-5(6)9-10(7)8/h5H,2-4H2,1H3,(H,7,8)/p-1 |
| InChIKey | OPMMPRTVHDZDGO-UHFFFAOYSA-M |
| XLogP | 1.55 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.65 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentyl sulfite?
The IUPAC name of 1-chloropentyl sulfite (CID 174423721) is 1-chloropentyl sulfite.
What is the SMILES notation for 1-chloropentyl sulfite?
The canonical SMILES for 1-chloropentyl sulfite is CCCCC(Cl)OS(=O)[O-].
What is the InChIKey of 1-chloropentyl sulfite?
The InChIKey is OPMMPRTVHDZDGO-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H11ClO3S/c1-2-3-4-5(6)9-10(7)8/h5H,2-4H2,1H3,(H,7,8)/p-1.
What are the key properties of 1-chloropentyl sulfite?
1-chloropentyl sulfite has a molecular weight of 185.65 g/mol, XLogP of 1.55, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentyl sulfite is sourced from PubChem (CID 174423721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).