About 1-chloropentyl 2-aminoacetate
1-chloropentyl 2-aminoacetate (PubChem CID 155272437) has the molecular formula C7H14ClNO2
and a molecular weight of 179.65 g/mol. Its IUPAC name is 1-chloropentyl 2-aminoacetate.
Molecular Properties
| Compound Name | 1-chloropentyl 2-aminoacetate |
| PubChem CID | 155272437 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 1-chloropentyl 2-aminoacetate |
| SMILES | CCCCC(Cl)OC(=O)CN |
| InChI | InChI=1S/C7H14ClNO2/c1-2-3-4-6(8)11-7(10)5-9/h6H,2-5,9H2,1H3 |
| InChIKey | YWJWTXHHFUEHNM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentyl 2-aminoacetate?
The IUPAC name of 1-chloropentyl 2-aminoacetate (CID 155272437) is 1-chloropentyl 2-aminoacetate.
What is the SMILES notation for 1-chloropentyl 2-aminoacetate?
The canonical SMILES for 1-chloropentyl 2-aminoacetate is CCCCC(Cl)OC(=O)CN.
What is the InChIKey of 1-chloropentyl 2-aminoacetate?
The InChIKey is YWJWTXHHFUEHNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14ClNO2/c1-2-3-4-6(8)11-7(10)5-9/h6H,2-5,9H2,1H3.
What are the key properties of 1-chloropentyl 2-aminoacetate?
1-chloropentyl 2-aminoacetate has a molecular weight of 179.65 g/mol, XLogP of 1.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentyl 2-aminoacetate is sourced from PubChem (CID 155272437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).