About bis(1-chloropentyl) 2-hydroxybutanedioate
bis(1-chloropentyl) 2-hydroxybutanedioate (PubChem CID 174547129) has the molecular formula C14H24Cl2O5
and a molecular weight of 343.25 g/mol. Its IUPAC name is bis(1-chloropentyl) 2-hydroxybutanedioate.
Molecular Properties
| Compound Name | bis(1-chloropentyl) 2-hydroxybutanedioate |
| PubChem CID | 174547129 |
| Molecular Formula | C14H24Cl2O5 |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | bis(1-chloropentyl) 2-hydroxybutanedioate |
| SMILES | CCCCC(Cl)OC(=O)CC(O)C(=O)OC(Cl)CCCC |
| InChI | InChI=1S/C14H24Cl2O5/c1-3-5-7-11(15)20-13(18)9-10(17)14(19)21-12(16)8-6-4-2/h10-12,17H,3-9H2,1-2H3 |
| InChIKey | JOCFFGQASAOYIT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bis(1-chloropentyl) 2-hydroxybutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-chloropentyl) 2-hydroxybutanedioate?
The IUPAC name of bis(1-chloropentyl) 2-hydroxybutanedioate (CID 174547129) is bis(1-chloropentyl) 2-hydroxybutanedioate.
What is the SMILES notation for bis(1-chloropentyl) 2-hydroxybutanedioate?
The canonical SMILES for bis(1-chloropentyl) 2-hydroxybutanedioate is CCCCC(Cl)OC(=O)CC(O)C(=O)OC(Cl)CCCC.
What is the InChIKey of bis(1-chloropentyl) 2-hydroxybutanedioate?
The InChIKey is JOCFFGQASAOYIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24Cl2O5/c1-3-5-7-11(15)20-13(18)9-10(17)14(19)21-12(16)8-6-4-2/h10-12,17H,3-9H2,1-2H3.
What are the key properties of bis(1-chloropentyl) 2-hydroxybutanedioate?
bis(1-chloropentyl) 2-hydroxybutanedioate has a molecular weight of 343.25 g/mol, XLogP of 3.33, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-chloropentyl) 2-hydroxybutanedioate is sourced from PubChem (CID 174547129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).