About 1-chlorooctyl methyl carbonate
1-chlorooctyl methyl carbonate (PubChem CID 88749433) has the molecular formula C10H19ClO3
and a molecular weight of 222.71 g/mol. Its IUPAC name is 1-chlorooctyl methyl carbonate.
Molecular Properties
| Compound Name | 1-chlorooctyl methyl carbonate |
| PubChem CID | 88749433 |
| Molecular Formula | C10H19ClO3 |
| Molecular Weight | 222.71 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-chlorooctyl methyl carbonate |
| SMILES | CCCCCCCC(Cl)OC(=O)OC |
| InChI | InChI=1S/C10H19ClO3/c1-3-4-5-6-7-8-9(11)14-10(12)13-2/h9H,3-8H2,1-2H3 |
| InChIKey | ANYAYSBLSNTWKN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.71 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorooctyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorooctyl methyl carbonate?
The IUPAC name of 1-chlorooctyl methyl carbonate (CID 88749433) is 1-chlorooctyl methyl carbonate.
What is the SMILES notation for 1-chlorooctyl methyl carbonate?
The canonical SMILES for 1-chlorooctyl methyl carbonate is CCCCCCCC(Cl)OC(=O)OC.
What is the InChIKey of 1-chlorooctyl methyl carbonate?
The InChIKey is ANYAYSBLSNTWKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19ClO3/c1-3-4-5-6-7-8-9(11)14-10(12)13-2/h9H,3-8H2,1-2H3.
What are the key properties of 1-chlorooctyl methyl carbonate?
1-chlorooctyl methyl carbonate has a molecular weight of 222.71 g/mol, XLogP of 3.69, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorooctyl methyl carbonate is sourced from PubChem (CID 88749433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).