About [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate
[(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate (PubChem CID 143801589) has the molecular formula C12H22ClNO3
and a molecular weight of 263.76 g/mol. Its IUPAC name is [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate.
Molecular Properties
| Compound Name | [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate |
| PubChem CID | 143801589 |
| Molecular Formula | C12H22ClNO3 |
| Molecular Weight | 263.76 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate |
| SMILES | CCCCC[C@@H](Cl)OC(=O)[C@@H](NC=O)C(C)C |
| InChI | InChI=1S/C12H22ClNO3/c1-4-5-6-7-10(13)17-12(16)11(9(2)3)14-8-15/h8-11H,4-7H2,1-3H3,(H,14,15)/t10-,11-/m0/s1 |
| InChIKey | JSJKYLLLLDCCIN-QWRGUYRKSA-N |
| XLogP | 2.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.76 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate?
The IUPAC name of [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate (CID 143801589) is [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate.
What is the SMILES notation for [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate?
The canonical SMILES for [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate is CCCCC[C@@H](Cl)OC(=O)[C@@H](NC=O)C(C)C.
What is the InChIKey of [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate?
The InChIKey is JSJKYLLLLDCCIN-QWRGUYRKSA-N. The full InChI is InChI=1S/C12H22ClNO3/c1-4-5-6-7-10(13)17-12(16)11(9(2)3)14-8-15/h8-11H,4-7H2,1-3H3,(H,14,15)/t10-,11-/m0/s1.
What are the key properties of [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate?
[(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate has a molecular weight of 263.76 g/mol, XLogP of 2.45, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-chlorohexyl] (2S)-2-formamido-3-methylbutanoate is sourced from PubChem (CID 143801589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).