About 1-cyanoheptyl methyl carbonate
1-cyanoheptyl methyl carbonate (PubChem CID 10420302) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-cyanoheptyl methyl carbonate.
Molecular Properties
| Compound Name | 1-cyanoheptyl methyl carbonate |
| PubChem CID | 10420302 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-cyanoheptyl methyl carbonate |
| SMILES | CCCCCCC(C#N)OC(=O)OC |
| InChI | InChI=1S/C10H17NO3/c1-3-4-5-6-7-9(8-11)14-10(12)13-2/h9H,3-7H2,1-2H3 |
| InChIKey | SWTRPADCCKSCPP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyanoheptyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyanoheptyl methyl carbonate?
The IUPAC name of 1-cyanoheptyl methyl carbonate (CID 10420302) is 1-cyanoheptyl methyl carbonate.
What is the SMILES notation for 1-cyanoheptyl methyl carbonate?
The canonical SMILES for 1-cyanoheptyl methyl carbonate is CCCCCCC(C#N)OC(=O)OC.
What is the InChIKey of 1-cyanoheptyl methyl carbonate?
The InChIKey is SWTRPADCCKSCPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-3-4-5-6-7-9(8-11)14-10(12)13-2/h9H,3-7H2,1-2H3.
What are the key properties of 1-cyanoheptyl methyl carbonate?
1-cyanoheptyl methyl carbonate has a molecular weight of 199.25 g/mol, XLogP of 2.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyanoheptyl methyl carbonate is sourced from PubChem (CID 10420302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).