C11H17NO3 — CID 102182290
[(E,1R)-1-cyanooct-2-enyl] methyl carbonate (PubChem CID 102182290) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is [(E,1R)-1-cyanooct-2-enyl] methyl carbonate.
| Compound Name | [(E,1R)-1-cyanooct-2-enyl] methyl carbonate |
|---|---|
| PubChem CID | 102182290 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [(E,1R)-1-cyanooct-2-enyl] methyl carbonate |
| SMILES | CCCCC/C=C/[C@H](C#N)OC(=O)OC |
| InChI | InChI=1S/C11H17NO3/c1-3-4-5-6-7-8-10(9-12)15-11(13)14-2/h7-8,10H,3-6H2,1-2H3/b8-7+/t10-/m1/s1 |
| InChIKey | INSBSIRKRYWRNH-QROSGCPLSA-N |
| XLogP | 2.80 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|