About [(1S)-1-cyanooctyl] propanoate
[(1S)-1-cyanooctyl] propanoate (PubChem CID 71354114) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is [(1S)-1-cyanooctyl] propanoate.
Molecular Properties
| Compound Name | [(1S)-1-cyanooctyl] propanoate |
| PubChem CID | 71354114 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | [(1S)-1-cyanooctyl] propanoate |
| SMILES | CCCCCCC[C@@H](C#N)OC(=O)CC |
| InChI | InChI=1S/C12H21NO2/c1-3-5-6-7-8-9-11(10-13)15-12(14)4-2/h11H,3-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | FANCGNNJNWWANW-NSHDSACASA-N |
| XLogP | 3.19 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-cyanooctyl] propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-cyanooctyl] propanoate?
The IUPAC name of [(1S)-1-cyanooctyl] propanoate (CID 71354114) is [(1S)-1-cyanooctyl] propanoate.
What is the SMILES notation for [(1S)-1-cyanooctyl] propanoate?
The canonical SMILES for [(1S)-1-cyanooctyl] propanoate is CCCCCCC[C@@H](C#N)OC(=O)CC.
What is the InChIKey of [(1S)-1-cyanooctyl] propanoate?
The InChIKey is FANCGNNJNWWANW-NSHDSACASA-N. The full InChI is InChI=1S/C12H21NO2/c1-3-5-6-7-8-9-11(10-13)15-12(14)4-2/h11H,3-9H2,1-2H3/t11-/m0/s1.
What are the key properties of [(1S)-1-cyanooctyl] propanoate?
[(1S)-1-cyanooctyl] propanoate has a molecular weight of 211.30 g/mol, XLogP of 3.19, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-cyanooctyl] propanoate is sourced from PubChem (CID 71354114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).