About [(1R)-1-cyanohexyl] ethyl carbonate
[(1R)-1-cyanohexyl] ethyl carbonate (PubChem CID 101208151) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is [(1R)-1-cyanohexyl] ethyl carbonate.
Molecular Properties
| Compound Name | [(1R)-1-cyanohexyl] ethyl carbonate |
| PubChem CID | 101208151 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [(1R)-1-cyanohexyl] ethyl carbonate |
| SMILES | CCCCC[C@H](C#N)OC(=O)OCC |
| InChI | InChI=1S/C10H17NO3/c1-3-5-6-7-9(8-11)14-10(12)13-4-2/h9H,3-7H2,1-2H3/t9-/m1/s1 |
| InChIKey | SKEWUTPYLHGIMF-SECBINFHSA-N |
| XLogP | 2.63 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(1R)-1-cyanohexyl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-1-cyanohexyl] ethyl carbonate?
The IUPAC name of [(1R)-1-cyanohexyl] ethyl carbonate (CID 101208151) is [(1R)-1-cyanohexyl] ethyl carbonate.
What is the SMILES notation for [(1R)-1-cyanohexyl] ethyl carbonate?
The canonical SMILES for [(1R)-1-cyanohexyl] ethyl carbonate is CCCCC[C@H](C#N)OC(=O)OCC.
What is the InChIKey of [(1R)-1-cyanohexyl] ethyl carbonate?
The InChIKey is SKEWUTPYLHGIMF-SECBINFHSA-N. The full InChI is InChI=1S/C10H17NO3/c1-3-5-6-7-9(8-11)14-10(12)13-4-2/h9H,3-7H2,1-2H3/t9-/m1/s1.
What are the key properties of [(1R)-1-cyanohexyl] ethyl carbonate?
[(1R)-1-cyanohexyl] ethyl carbonate has a molecular weight of 199.25 g/mol, XLogP of 2.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-1-cyanohexyl] ethyl carbonate is sourced from PubChem (CID 101208151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).