C7H16NO6S- — CID 138635010
1-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propan-2-yl sulfite (PubChem CID 138635010) has the molecular formula C7H16NO6S- and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propan-2-yl sulfite.
| Compound Name | 1-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propan-2-yl sulfite |
|---|---|
| PubChem CID | 138635010 |
| Molecular Formula | C7H16NO6S- |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]propan-2-yl sulfite |
| SMILES | CC(CNC(CO)(CO)CO)OS(=O)[O-] |
| InChI | InChI=1S/C7H17NO6S/c1-6(14-15(12)13)2-8-7(3-9,4-10)5-11/h6,8-11H,2-5H2,1H3,(H,12,13)/p-1 |
| InChIKey | MUUSXMRYKCGXOE-UHFFFAOYSA-M |
| XLogP | -2.51 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|