About 1-aminopropan-2-yl sulfite
1-aminopropan-2-yl sulfite (PubChem CID 174396129) has the molecular formula C3H8NO3S-
and a molecular weight of 138.17 g/mol. Its IUPAC name is 1-aminopropan-2-yl sulfite.
Molecular Properties
| Compound Name | 1-aminopropan-2-yl sulfite |
| PubChem CID | 174396129 |
| Molecular Formula | C3H8NO3S- |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.02 |
| IUPAC Name | 1-aminopropan-2-yl sulfite |
| SMILES | CC(CN)OS(=O)[O-] |
| InChI | InChI=1S/C3H9NO3S/c1-3(2-4)7-8(5)6/h3H,2,4H2,1H3,(H,5,6)/p-1 |
| InChIKey | DFZBCZLWSHWCSQ-UHFFFAOYSA-M |
| XLogP | -0.86 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropan-2-yl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-yl sulfite?
The IUPAC name of 1-aminopropan-2-yl sulfite (CID 174396129) is 1-aminopropan-2-yl sulfite.
What is the SMILES notation for 1-aminopropan-2-yl sulfite?
The canonical SMILES for 1-aminopropan-2-yl sulfite is CC(CN)OS(=O)[O-].
What is the InChIKey of 1-aminopropan-2-yl sulfite?
The InChIKey is DFZBCZLWSHWCSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H9NO3S/c1-3(2-4)7-8(5)6/h3H,2,4H2,1H3,(H,5,6)/p-1.
What are the key properties of 1-aminopropan-2-yl sulfite?
1-aminopropan-2-yl sulfite has a molecular weight of 138.17 g/mol, XLogP of -0.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-yl sulfite is sourced from PubChem (CID 174396129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).