C7H11O5S- — CID 175560298
1-(2-methylprop-2-enoyloxy)propan-2-yl sulfite (PubChem CID 175560298) has the molecular formula C7H11O5S- and a molecular weight of 207.23 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoyloxy)propan-2-yl sulfite.
| Compound Name | 1-(2-methylprop-2-enoyloxy)propan-2-yl sulfite |
|---|---|
| PubChem CID | 175560298 |
| Molecular Formula | C7H11O5S- |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.03 |
| IUPAC Name | 1-(2-methylprop-2-enoyloxy)propan-2-yl sulfite |
| SMILES | C=C(C)C(=O)OCC(C)OS(=O)[O-] |
| InChI | InChI=1S/C7H12O5S/c1-5(2)7(8)11-4-6(3)12-13(9)10/h6H,1,4H2,2-3H3,(H,9,10)/p-1 |
| InChIKey | GFOHAKWXBNFOTA-UHFFFAOYSA-M |
| XLogP | 0.30 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|