C5H6F3O5S- — CID 118684443
[1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] sulfite (PubChem CID 118684443) has the molecular formula C5H6F3O5S- and a molecular weight of 235.16 g/mol. Its IUPAC name is [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] sulfite.
| Compound Name | [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] sulfite |
|---|---|
| PubChem CID | 118684443 |
| Molecular Formula | C5H6F3O5S- |
| Molecular Weight | 235.16 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | [1-oxo-1-(2,2,2-trifluoroethoxy)propan-2-yl] sulfite |
| SMILES | CC(OS(=O)[O-])C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C5H7F3O5S/c1-3(13-14(10)11)4(9)12-2-5(6,7)8/h3H,2H2,1H3,(H,10,11)/p-1 |
| InChIKey | FDNSZIBKTFELNO-UHFFFAOYSA-M |
| XLogP | 0.29 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.16 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|