C11H12F3NO3 — CID 100616854
2,2,2-trifluoroethyl (2S)-2-(3-aminophenoxy)propanoate (PubChem CID 100616854) has the molecular formula C11H12F3NO3 and a molecular weight of 263.22 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (2S)-2-(3-aminophenoxy)propanoate.
| Compound Name | 2,2,2-trifluoroethyl (2S)-2-(3-aminophenoxy)propanoate |
|---|---|
| PubChem CID | 100616854 |
| Molecular Formula | C11H12F3NO3 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 2,2,2-trifluoroethyl (2S)-2-(3-aminophenoxy)propanoate |
| SMILES | C[C@H](Oc1cccc(N)c1)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C11H12F3NO3/c1-7(10(16)17-6-11(12,13)14)18-9-4-2-3-8(15)5-9/h2-5,7H,6,15H2,1H3/t7-/m0/s1 |
| InChIKey | YPYFLXYJSARJCT-ZETCQYMHSA-N |
| XLogP | 2.14 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|