C11H11F4NO3 — CID 81339909
2-(3-fluorophenoxy)-N-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 81339909) has the molecular formula C11H11F4NO3 and a molecular weight of 281.20 g/mol. Its IUPAC name is 2-(3-fluorophenoxy)-N-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | 2-(3-fluorophenoxy)-N-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 81339909 |
| Molecular Formula | C11H11F4NO3 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 2-(3-fluorophenoxy)-N-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | CC(Oc1cccc(F)c1)C(=O)NOCC(F)(F)F |
| InChI | InChI=1S/C11H11F4NO3/c1-7(10(17)16-18-6-11(13,14)15)19-9-4-2-3-8(12)5-9/h2-5,7H,6H2,1H3,(H,16,17) |
| InChIKey | MDPOETGXFZTMIE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|