C15H20FNO4 — CID 61155162
(2S)-2-[2-(3-fluorophenoxy)propanoylamino]-4-methylpentanoic acid (PubChem CID 61155162) has the molecular formula C15H20FNO4 and a molecular weight of 297.33 g/mol. Its IUPAC name is (2S)-2-[2-(3-fluorophenoxy)propanoylamino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[2-(3-fluorophenoxy)propanoylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 61155162 |
| Molecular Formula | C15H20FNO4 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (2S)-2-[2-(3-fluorophenoxy)propanoylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)C(C)Oc1cccc(F)c1)C(=O)O |
| InChI | InChI=1S/C15H20FNO4/c1-9(2)7-13(15(19)20)17-14(18)10(3)21-12-6-4-5-11(16)8-12/h4-6,8-10,13H,7H2,1-3H3,(H,17,18)(H,19,20)/t10?,13-/m0/s1 |
| InChIKey | ATGWQRQLLKVZMQ-HQVZTVAUSA-N |
| XLogP | 2.21 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |