C12H14FNO5 — CID 107833758
(2S)-3-[2-(3-fluorophenoxy)propanoylamino]-2-hydroxypropanoic acid (PubChem CID 107833758) has the molecular formula C12H14FNO5 and a molecular weight of 271.24 g/mol. Its IUPAC name is (2S)-3-[2-(3-fluorophenoxy)propanoylamino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[2-(3-fluorophenoxy)propanoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107833758 |
| Molecular Formula | C12H14FNO5 |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (2S)-3-[2-(3-fluorophenoxy)propanoylamino]-2-hydroxypropanoic acid |
| SMILES | CC(Oc1cccc(F)c1)C(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H14FNO5/c1-7(11(16)14-6-10(15)12(17)18)19-9-4-2-3-8(13)5-9/h2-5,7,10,15H,6H2,1H3,(H,14,16)(H,17,18)/t7?,10-/m0/s1 |
| InChIKey | BQEOAWVEYOPTQZ-MHPPCMCBSA-N |
| XLogP | 0.15 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |