C11H12O4S — CID 174760212
4-(benzenesulfinylmethyl)-1,3-dioxolane-2-carbaldehyde (PubChem CID 174760212) has the molecular formula C11H12O4S and a molecular weight of 240.28 g/mol. Its IUPAC name is 4-(benzenesulfinylmethyl)-1,3-dioxolane-2-carbaldehyde.
| Compound Name | 4-(benzenesulfinylmethyl)-1,3-dioxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 174760212 |
| Molecular Formula | C11H12O4S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 4-(benzenesulfinylmethyl)-1,3-dioxolane-2-carbaldehyde |
| SMILES | O=CC1OCC(CS(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C11H12O4S/c12-6-11-14-7-9(15-11)8-16(13)10-4-2-1-3-5-10/h1-6,9,11H,7-8H2 |
| InChIKey | RNSWSXLBPPSTKV-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|