C11H14O2S2 — CID 86038140
2-(benzenesulfinylmethyl)-1,3-oxathiane (PubChem CID 86038140) has the molecular formula C11H14O2S2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-(benzenesulfinylmethyl)-1,3-oxathiane.
| Compound Name | 2-(benzenesulfinylmethyl)-1,3-oxathiane |
|---|---|
| PubChem CID | 86038140 |
| Molecular Formula | C11H14O2S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-(benzenesulfinylmethyl)-1,3-oxathiane |
| SMILES | O=S(CC1OCCCS1)c1ccccc1 |
| InChI | InChI=1S/C11H14O2S2/c12-15(10-5-2-1-3-6-10)9-11-13-7-4-8-14-11/h1-3,5-6,11H,4,7-9H2 |
| InChIKey | SQBVPZHKDPBJTB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |