About 2-(benzenesulfinylmethyl)-1,3-oxathiane
2-(benzenesulfinylmethyl)-1,3-oxathiane (PubChem CID 86038140) has the molecular formula C11H14O2S2
and a molecular weight of 242.36 g/mol. Its IUPAC name is 2-(benzenesulfinylmethyl)-1,3-oxathiane.
Molecular Properties
| Compound Name | 2-(benzenesulfinylmethyl)-1,3-oxathiane |
| PubChem CID | 86038140 |
| Molecular Formula | C11H14O2S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-(benzenesulfinylmethyl)-1,3-oxathiane |
| SMILES | O=S(CC1OCCCS1)c1ccccc1 |
| InChI | InChI=1S/C11H14O2S2/c12-15(10-5-2-1-3-6-10)9-11-13-7-4-8-14-11/h1-3,5-6,11H,4,7-9H2 |
| InChIKey | SQBVPZHKDPBJTB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(benzenesulfinylmethyl)-1,3-oxathiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfinylmethyl)-1,3-oxathiane?
The IUPAC name of 2-(benzenesulfinylmethyl)-1,3-oxathiane (CID 86038140) is 2-(benzenesulfinylmethyl)-1,3-oxathiane.
What is the SMILES notation for 2-(benzenesulfinylmethyl)-1,3-oxathiane?
The canonical SMILES for 2-(benzenesulfinylmethyl)-1,3-oxathiane is O=S(CC1OCCCS1)c1ccccc1.
What is the InChIKey of 2-(benzenesulfinylmethyl)-1,3-oxathiane?
The InChIKey is SQBVPZHKDPBJTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2S2/c12-15(10-5-2-1-3-6-10)9-11-13-7-4-8-14-11/h1-3,5-6,11H,4,7-9H2.
What are the key properties of 2-(benzenesulfinylmethyl)-1,3-oxathiane?
2-(benzenesulfinylmethyl)-1,3-oxathiane has a molecular weight of 242.36 g/mol, XLogP of 2.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfinylmethyl)-1,3-oxathiane is sourced from PubChem (CID 86038140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).