C10H18OS3 — CID 154527886
2-[(2-methyl-1,3-dithian-5-yl)methyl]-1,3-oxathiane (PubChem CID 154527886) has the molecular formula C10H18OS3 and a molecular weight of 250.45 g/mol. Its IUPAC name is 2-[(2-methyl-1,3-dithian-5-yl)methyl]-1,3-oxathiane.
| Compound Name | 2-[(2-methyl-1,3-dithian-5-yl)methyl]-1,3-oxathiane |
|---|---|
| PubChem CID | 154527886 |
| Molecular Formula | C10H18OS3 |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 2-[(2-methyl-1,3-dithian-5-yl)methyl]-1,3-oxathiane |
| SMILES | CC1SCC(CC2OCCCS2)CS1 |
| InChI | InChI=1S/C10H18OS3/c1-8-13-6-9(7-14-8)5-10-11-3-2-4-12-10/h8-10H,2-7H2,1H3 |
| InChIKey | FFQKBYILLHUYDE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |