C16H14O3S2 — CID 79228434
4-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfinyl)benzoic acid (PubChem CID 79228434) has the molecular formula C16H14O3S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfinyl)benzoic acid.
| Compound Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfinyl)benzoic acid |
|---|---|
| PubChem CID | 79228434 |
| Molecular Formula | C16H14O3S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfinyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)CC2Cc3ccccc3S2)cc1 |
| InChI | InChI=1S/C16H14O3S2/c17-16(18)11-5-7-14(8-6-11)21(19)10-13-9-12-3-1-2-4-15(12)20-13/h1-8,13H,9-10H2,(H,17,18) |
| InChIKey | HEQIEIALTIDKQM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |