C16H22O3S — CID 10517908
(4R,6S)-4-(benzenesulfinylmethyl)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxane (PubChem CID 10517908) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is (4R,6S)-4-(benzenesulfinylmethyl)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxane.
| Compound Name | (4R,6S)-4-(benzenesulfinylmethyl)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 10517908 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (4R,6S)-4-(benzenesulfinylmethyl)-2,2-dimethyl-6-prop-2-enyl-1,3-dioxane |
| SMILES | C=CC[C@H]1C[C@H](CS(=O)c2ccccc2)OC(C)(C)O1 |
| InChI | InChI=1S/C16H22O3S/c1-4-8-13-11-14(19-16(2,3)18-13)12-20(17)15-9-6-5-7-10-15/h4-7,9-10,13-14H,1,8,11-12H2,2-3H3/t13-,14+,20?/m0/s1 |
| InChIKey | NVCDQCHJURLYLX-IODPJOFQSA-N |
| XLogP | 3.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|