C18H27NO5S — CID 101359920
2-[(4R,6R)-2,2-dimethyl-6-[(4-methylphenyl)sulfinylmethyl]-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide (PubChem CID 101359920) has the molecular formula C18H27NO5S and a molecular weight of 369.48 g/mol. Its IUPAC name is 2-[(4R,6R)-2,2-dimethyl-6-[(4-methylphenyl)sulfinylmethyl]-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[(4R,6R)-2,2-dimethyl-6-[(4-methylphenyl)sulfinylmethyl]-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 101359920 |
| Molecular Formula | C18H27NO5S |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2-[(4R,6R)-2,2-dimethyl-6-[(4-methylphenyl)sulfinylmethyl]-1,3-dioxan-4-yl]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)C[C@H]1C[C@H](CS(=O)c2ccc(C)cc2)OC(C)(C)O1 |
| InChI | InChI=1S/C18H27NO5S/c1-13-6-8-16(9-7-13)25(21)12-15-10-14(23-18(2,3)24-15)11-17(20)19(4)22-5/h6-9,14-15H,10-12H2,1-5H3/t14-,15-,25?/m1/s1 |
| InChIKey | FPWNOELKJIXZJE-GXICYEEUSA-N |
| XLogP | 2.42 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|