C18H27BrO3S — CID 12000407
(4S,5S,6R)-5-bromo-4-butyl-2,2-dimethyl-6-[[(R)-(4-methylphenyl)sulfinyl]methyl]-1,3-dioxane (PubChem CID 12000407) has the molecular formula C18H27BrO3S and a molecular weight of 403.38 g/mol. Its IUPAC name is (4S,5S,6R)-5-bromo-4-butyl-2,2-dimethyl-6-[[(R)-(4-methylphenyl)sulfinyl]methyl]-1,3-dioxane.
| Compound Name | (4S,5S,6R)-5-bromo-4-butyl-2,2-dimethyl-6-[[(R)-(4-methylphenyl)sulfinyl]methyl]-1,3-dioxane |
|---|---|
| PubChem CID | 12000407 |
| Molecular Formula | C18H27BrO3S |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (4S,5S,6R)-5-bromo-4-butyl-2,2-dimethyl-6-[[(R)-(4-methylphenyl)sulfinyl]methyl]-1,3-dioxane |
| SMILES | CCCC[C@@H]1OC(C)(C)O[C@H](C[S@@](=O)c2ccc(C)cc2)[C@H]1Br |
| InChI | InChI=1S/C18H27BrO3S/c1-5-6-7-15-17(19)16(22-18(3,4)21-15)12-23(20)14-10-8-13(2)9-11-14/h8-11,15-17H,5-7,12H2,1-4H3/t15-,16+,17-,23+/m0/s1 |
| InChIKey | LFDLVXAFNCEWIC-OIMWQHCXSA-N |
| XLogP | 4.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|