C20H23N3O3S — CID 11463286
(4R,5S,6R)-5-azido-2,2-dimethyl-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]-6-phenyl-1,3-dioxane (PubChem CID 11463286) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is (4R,5S,6R)-5-azido-2,2-dimethyl-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]-6-phenyl-1,3-dioxane.
| Compound Name | (4R,5S,6R)-5-azido-2,2-dimethyl-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]-6-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 11463286 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (4R,5S,6R)-5-azido-2,2-dimethyl-4-[[(S)-(4-methylphenyl)sulfinyl]methyl]-6-phenyl-1,3-dioxane |
| SMILES | Cc1ccc([S@@](=O)C[C@@H]2OC(C)(C)O[C@H](c3ccccc3)[C@@H]2N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C20H23N3O3S/c1-14-9-11-16(12-10-14)27(24)13-17-18(22-23-21)19(26-20(2,3)25-17)15-7-5-4-6-8-15/h4-12,17-19H,13H2,1-3H3/t17-,18+,19+,27-/m0/s1 |
| InChIKey | LZTMBCBVSGNOGR-CBAWNUHDSA-N |
| XLogP | 4.67 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|