C15H19IO3S — CID 101070411
(4S,5S)-4-(iodomethyl)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfinylethenyl]-1,3-dioxolane (PubChem CID 101070411) has the molecular formula C15H19IO3S and a molecular weight of 406.29 g/mol. Its IUPAC name is (4S,5S)-4-(iodomethyl)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfinylethenyl]-1,3-dioxolane.
| Compound Name | (4S,5S)-4-(iodomethyl)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfinylethenyl]-1,3-dioxolane |
|---|---|
| PubChem CID | 101070411 |
| Molecular Formula | C15H19IO3S |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | (4S,5S)-4-(iodomethyl)-2,2-dimethyl-5-[(E)-2-(4-methylphenyl)sulfinylethenyl]-1,3-dioxolane |
| SMILES | Cc1ccc(S(=O)/C=C/[C@@H]2OC(C)(C)O[C@@H]2CI)cc1 |
| InChI | InChI=1S/C15H19IO3S/c1-11-4-6-12(7-5-11)20(17)9-8-13-14(10-16)19-15(2,3)18-13/h4-9,13-14H,10H2,1-3H3/b9-8+/t13-,14+,20?/m0/s1 |
| InChIKey | IFGQGXMOIGDIBA-PFCQAVANSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|